C11H9Cl2NO2 — CID 54242641
2-(4,6-dichloro-2-hydroxy-2,3-dihydroinden-1-ylidene)acetamide (PubChem CID 54242641) has the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. Its IUPAC name is 2-(4,6-dichloro-2-hydroxy-2,3-dihydroinden-1-ylidene)acetamide.
| Compound Name | 2-(4,6-dichloro-2-hydroxy-2,3-dihydroinden-1-ylidene)acetamide |
|---|---|
| PubChem CID | 54242641 |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 2-(4,6-dichloro-2-hydroxy-2,3-dihydroinden-1-ylidene)acetamide |
| SMILES | NC(=O)C=C1c2cc(Cl)cc(Cl)c2CC1O |
| InChI | InChI=1S/C11H9Cl2NO2/c12-5-1-6-7(9(13)2-5)3-10(15)8(6)4-11(14)16/h1-2,4,10,15H,3H2,(H2,14,16) |
| InChIKey | QRBVNGJLVATNJY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|