C14H14Cl2O3 — CID 13254254
5-(5,7-dichloro-3-oxo-1,2-dihydroinden-2-yl)pentanoic acid (PubChem CID 13254254) has the molecular formula C14H14Cl2O3 and a molecular weight of 301.17 g/mol. Its IUPAC name is 5-(5,7-dichloro-3-oxo-1,2-dihydroinden-2-yl)pentanoic acid.
| Compound Name | 5-(5,7-dichloro-3-oxo-1,2-dihydroinden-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 13254254 |
| Molecular Formula | C14H14Cl2O3 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 5-(5,7-dichloro-3-oxo-1,2-dihydroinden-2-yl)pentanoic acid |
| SMILES | O=C(O)CCCCC1Cc2c(Cl)cc(Cl)cc2C1=O |
| InChI | InChI=1S/C14H14Cl2O3/c15-9-6-11-10(12(16)7-9)5-8(14(11)19)3-1-2-4-13(17)18/h6-8H,1-5H2,(H,17,18) |
| InChIKey | JRNUXOUEJOKBLC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|