C10H11Cl2NO — CID 45043209
1-amino-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 45043209) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 1-amino-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 1-amino-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 45043209 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 1-amino-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | NC1c2cc(Cl)cc(Cl)c2CCC1O |
| InChI | InChI=1S/C10H11Cl2NO/c11-5-3-7-6(8(12)4-5)1-2-9(14)10(7)13/h3-4,9-10,14H,1-2,13H2 |
| InChIKey | IKXGQSRJGUAIKS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |