C9H7Cl3 — CID 94828375
(1S)-1,4,6-trichloro-2,3-dihydro-1H-indene (PubChem CID 94828375) has the molecular formula C9H7Cl3 and a molecular weight of 221.51 g/mol. Its IUPAC name is (1S)-1,4,6-trichloro-2,3-dihydro-1H-indene.
| Compound Name | (1S)-1,4,6-trichloro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 94828375 |
| Molecular Formula | C9H7Cl3 |
| Molecular Weight | 221.51 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | (1S)-1,4,6-trichloro-2,3-dihydro-1H-indene |
| SMILES | Clc1cc(Cl)c2c(c1)[C@@H](Cl)CC2 |
| InChI | InChI=1S/C9H7Cl3/c10-5-3-7-6(9(12)4-5)1-2-8(7)11/h3-4,8H,1-2H2/t8-/m0/s1 |
| InChIKey | QZOQWLZEVHEWLA-QMMMGPOBSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|