About 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole
8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole (PubChem CID 90767360) has the molecular formula C10H8N2O4
and a molecular weight of 220.18 g/mol. Its IUPAC name is 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole.
Molecular Properties
| Compound Name | 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole |
| PubChem CID | 90767360 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1=C(CON1)CO2 |
| InChI | InChI=1S/C10H8N2O4/c13-12(14)7-1-2-9-8(3-7)10-6(4-15-9)5-16-11-10/h1-3,11H,4-5H2 |
| InChIKey | KWLFAVLYSUWEFV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole?
The IUPAC name of 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole (CID 90767360) is 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole.
What is the SMILES notation for 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole?
The canonical SMILES for 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole is O=[N+]([O-])c1ccc2c(c1)C1=C(CON1)CO2.
What is the InChIKey of 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole?
The InChIKey is KWLFAVLYSUWEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4/c13-12(14)7-1-2-9-8(3-7)10-6(4-15-9)5-16-11-10/h1-3,11H,4-5H2.
What are the key properties of 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole?
8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole has a molecular weight of 220.18 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole is sourced from PubChem (CID 90767360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).