C10H8N2O4 — CID 90767360
8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole (PubChem CID 90767360) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole.
| Compound Name | 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole |
|---|---|
| PubChem CID | 90767360 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 8-nitro-3,4-dihydro-1H-chromeno[4,3-c][1,2]oxazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1=C(CON1)CO2 |
| InChI | InChI=1S/C10H8N2O4/c13-12(14)7-1-2-9-8(3-7)10-6(4-15-9)5-16-11-10/h1-3,11H,4-5H2 |
| InChIKey | KWLFAVLYSUWEFV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|