C11H8N2O3 — CID 59410519
8-nitro-4H-pyrrolo[2,1-c][1,4]benzoxazine (PubChem CID 59410519) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 8-nitro-4H-pyrrolo[2,1-c][1,4]benzoxazine.
| Compound Name | 8-nitro-4H-pyrrolo[2,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 59410519 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 8-nitro-4H-pyrrolo[2,1-c][1,4]benzoxazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)-n1cccc1CO2 |
| InChI | InChI=1S/C11H8N2O3/c14-13(15)8-3-4-11-10(6-8)12-5-1-2-9(12)7-16-11/h1-6H,7H2 |
| InChIKey | VDGJWMYPRVASFV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|