C11H13F3N2O2 — CID 82785995
4-amino-3-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid (PubChem CID 82785995) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 4-amino-3-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid.
| Compound Name | 4-amino-3-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 82785995 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-amino-3-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid |
| SMILES | CCN(CC(F)(F)F)c1cc(C(=O)O)ccc1N |
| InChI | InChI=1S/C11H13F3N2O2/c1-2-16(6-11(12,13)14)9-5-7(10(17)18)3-4-8(9)15/h3-5H,2,6,15H2,1H3,(H,17,18) |
| InChIKey | COEFFVKOFKLKOK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|