C11H12F4N2O2 — CID 83207181
2-amino-6-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzoic acid (PubChem CID 83207181) has the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 2-amino-6-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83207181 |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-amino-6-[ethyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzoic acid |
| SMILES | CCN(CC(F)(F)F)c1ccc(F)c(N)c1C(=O)O |
| InChI | InChI=1S/C11H12F4N2O2/c1-2-17(5-11(13,14)15)7-4-3-6(12)9(16)8(7)10(18)19/h3-4H,2,5,16H2,1H3,(H,18,19) |
| InChIKey | JKRLLICVTNMPGO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|