C11H10F5NO2 — CID 107935629
4-[ethyl(2,2,2-trifluoroethyl)amino]-2,3-difluorobenzoic acid (PubChem CID 107935629) has the molecular formula C11H10F5NO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]-2,3-difluorobenzoic acid.
| Compound Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 107935629 |
| Molecular Formula | C11H10F5NO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-2,3-difluorobenzoic acid |
| SMILES | CCN(CC(F)(F)F)c1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C11H10F5NO2/c1-2-17(5-11(14,15)16)7-4-3-6(10(18)19)8(12)9(7)13/h3-4H,2,5H2,1H3,(H,18,19) |
| InChIKey | YTPVLXRVQIERIG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |