4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid

C12H16F2N2O2 — CID 107935744

IUPAC4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid
SMILESCN(C)CCN(C)c1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C12H16F2N2O2/c1-15(2)6-7-16(3)9-5-4-8(12(17)18)10(13)11(9)14/h4-5H,6-7H2,1-3H3,(H,17,18)
InChIKeyJSRCKZAWGQPEAH-UHFFFAOYSA-N
MW258.27 g/mol
LogP1.66
Rot. Bonds5

About 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid

4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid (PubChem CID 107935744) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid.

Molecular Properties

Compound Name4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid
PubChem CID107935744
Molecular FormulaC12H16F2N2O2
Molecular Weight258.27 g/mol
Exact Mass258.12
IUPAC Name4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid
SMILESCN(C)CCN(C)c1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C12H16F2N2O2/c1-15(2)6-7-16(3)9-5-4-8(12(17)18)10(13)11(9)14/h4-5H,6-7H2,1-3H3,(H,17,18)
InChIKeyJSRCKZAWGQPEAH-UHFFFAOYSA-N
XLogP1.66
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.27
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid?
The IUPAC name of 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid (CID 107935744) is 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid.
What is the SMILES notation for 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid?
The canonical SMILES for 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid is CN(C)CCN(C)c1ccc(C(=O)O)c(F)c1F.
What is the InChIKey of 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid?
The InChIKey is JSRCKZAWGQPEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2O2/c1-15(2)6-7-16(3)9-5-4-8(12(17)18)10(13)11(9)14/h4-5H,6-7H2,1-3H3,(H,17,18).
What are the key properties of 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid?
4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid has a molecular weight of 258.27 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid is sourced from PubChem (CID 107935744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).