C12H16F2N2O2 — CID 107935744
4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid (PubChem CID 107935744) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid.
| Compound Name | 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 107935744 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl-methylamino]-2,3-difluorobenzoic acid |
| SMILES | CN(C)CCN(C)c1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C12H16F2N2O2/c1-15(2)6-7-16(3)9-5-4-8(12(17)18)10(13)11(9)14/h4-5H,6-7H2,1-3H3,(H,17,18) |
| InChIKey | JSRCKZAWGQPEAH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |