C15H14F2N2O2 — CID 107935617
2,3-difluoro-4-[methyl(2-pyridin-4-ylethyl)amino]benzoic acid (PubChem CID 107935617) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2,3-difluoro-4-[methyl(2-pyridin-4-ylethyl)amino]benzoic acid.
| Compound Name | 2,3-difluoro-4-[methyl(2-pyridin-4-ylethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107935617 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2,3-difluoro-4-[methyl(2-pyridin-4-ylethyl)amino]benzoic acid |
| SMILES | CN(CCc1ccncc1)c1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C15H14F2N2O2/c1-19(9-6-10-4-7-18-8-5-10)12-3-2-11(15(20)21)13(16)14(12)17/h2-5,7-8H,6,9H2,1H3,(H,20,21) |
| InChIKey | XJMSAIOVNQZJOF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |