C13H17F2NO3 — CID 114017930
4-[2-ethoxyethyl(ethyl)amino]-2,3-difluorobenzoic acid (PubChem CID 114017930) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is 4-[2-ethoxyethyl(ethyl)amino]-2,3-difluorobenzoic acid.
| Compound Name | 4-[2-ethoxyethyl(ethyl)amino]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 114017930 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-[2-ethoxyethyl(ethyl)amino]-2,3-difluorobenzoic acid |
| SMILES | CCOCCN(CC)c1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C13H17F2NO3/c1-3-16(7-8-19-4-2)10-6-5-9(13(17)18)11(14)12(10)15/h5-6H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | VAQZJSNZNOSLAC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|