C11H11ClF3NO2 — CID 62946083
2-chloro-4-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid (PubChem CID 62946083) has the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. Its IUPAC name is 2-chloro-4-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 62946083 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-chloro-4-[ethyl(2,2,2-trifluoroethyl)amino]benzoic acid |
| SMILES | CCN(CC(F)(F)F)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClF3NO2/c1-2-16(6-11(13,14)15)7-3-4-8(10(17)18)9(12)5-7/h3-5H,2,6H2,1H3,(H,17,18) |
| InChIKey | LCXAYLVUKGPLRC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |