About 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid
4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid (PubChem CID 55009203) has the molecular formula C10H11F3N2O2
and a molecular weight of 248.20 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid.
Analyze 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid?
The IUPAC name of 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid (CID 55009203) is 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid.
What is the SMILES notation for 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid?
The canonical SMILES for 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid is CCN(CC(F)(F)F)c1ccnc(C(=O)O)c1.
What is the InChIKey of 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid?
The InChIKey is RNYRGFHXWDUJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O2/c1-2-15(6-10(11,12)13)7-3-4-14-8(5-7)9(16)17/h3-5H,2,6H2,1H3,(H,16,17).
What are the key properties of 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid?
4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid has a molecular weight of 248.20 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethyl(2,2,2-trifluoroethyl)amino]pyridine-2-carboxylic acid is sourced from PubChem (CID 55009203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).