C11H11BrF3NO2 — CID 114062253
3-bromo-4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzaldehyde (PubChem CID 114062253) has the molecular formula C11H11BrF3NO2 and a molecular weight of 326.11 g/mol. Its IUPAC name is 3-bromo-4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzaldehyde.
| Compound Name | 3-bromo-4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzaldehyde |
|---|---|
| PubChem CID | 114062253 |
| Molecular Formula | C11H11BrF3NO2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 3-bromo-4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzaldehyde |
| SMILES | O=Cc1ccc(N(CCO)CC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrF3NO2/c12-9-5-8(6-18)1-2-10(9)16(3-4-17)7-11(13,14)15/h1-2,5-6,17H,3-4,7H2 |
| InChIKey | FCXKEMTYVDYPGJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|