C12H12F5NO2 — CID 107480684
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzaldehyde (PubChem CID 107480684) has the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzaldehyde.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 107480684 |
| Molecular Formula | C12H12F5NO2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1ccc(N(CCO)CC(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F5NO2/c13-11(14)6-18(3-4-19)10-2-1-8(7-20)5-9(10)12(15,16)17/h1-2,5,7,11,19H,3-4,6H2 |
| InChIKey | FTLCYFKFLNWAAO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|