C12H14F3NO2 — CID 114230304
4-[3-hydroxypropyl(methyl)amino]-3-(trifluoromethyl)benzaldehyde (PubChem CID 114230304) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-[3-hydroxypropyl(methyl)amino]-3-(trifluoromethyl)benzaldehyde.
| Compound Name | 4-[3-hydroxypropyl(methyl)amino]-3-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 114230304 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-[3-hydroxypropyl(methyl)amino]-3-(trifluoromethyl)benzaldehyde |
| SMILES | CN(CCCO)c1ccc(C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2/c1-16(5-2-6-17)11-4-3-9(8-18)7-10(11)12(13,14)15/h3-4,7-8,17H,2,5-6H2,1H3 |
| InChIKey | BBXUMEGZOMCXLU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|