C12H13F5N2OS — CID 107479827
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 107479827) has the molecular formula C12H13F5N2OS and a molecular weight of 328.31 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107479827 |
| Molecular Formula | C12H13F5N2OS |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(C(F)(F)F)ccc1N(CCO)CC(F)F |
| InChI | InChI=1S/C12H13F5N2OS/c13-10(14)6-19(3-4-20)9-2-1-7(12(15,16)17)5-8(9)11(18)21/h1-2,5,10,20H,3-4,6H2,(H2,18,21) |
| InChIKey | OQJOWONYDSRMTP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|