C10H13F2IN2O — CID 107478099
2-[4-amino-N-(2,2-difluoroethyl)-2-iodoanilino]ethanol (PubChem CID 107478099) has the molecular formula C10H13F2IN2O and a molecular weight of 342.13 g/mol. Its IUPAC name is 2-[4-amino-N-(2,2-difluoroethyl)-2-iodoanilino]ethanol.
| Compound Name | 2-[4-amino-N-(2,2-difluoroethyl)-2-iodoanilino]ethanol |
|---|---|
| PubChem CID | 107478099 |
| Molecular Formula | C10H13F2IN2O |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-[4-amino-N-(2,2-difluoroethyl)-2-iodoanilino]ethanol |
| SMILES | Nc1ccc(N(CCO)CC(F)F)c(I)c1 |
| InChI | InChI=1S/C10H13F2IN2O/c11-10(12)6-15(3-4-16)9-2-1-7(14)5-8(9)13/h1-2,5,10,16H,3-4,6,14H2 |
| InChIKey | QOVBISUHJBDCKC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|