C11H14F2N4O — CID 107491312
2-[(5-amino-1H-indazol-6-yl)-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107491312) has the molecular formula C11H14F2N4O and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[(5-amino-1H-indazol-6-yl)-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[(5-amino-1H-indazol-6-yl)-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107491312 |
| Molecular Formula | C11H14F2N4O |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[(5-amino-1H-indazol-6-yl)-(2,2-difluoroethyl)amino]ethanol |
| SMILES | Nc1cc2cn[nH]c2cc1N(CCO)CC(F)F |
| InChI | InChI=1S/C11H14F2N4O/c12-11(13)6-17(1-2-18)10-4-9-7(3-8(10)14)5-15-16-9/h3-5,11,18H,1-2,6,14H2,(H,15,16) |
| InChIKey | NYTNKWDVLMKEEP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|