C11H16N4S — CID 107490850
6-N-methyl-6-N-(2-methylsulfanylethyl)-1H-indazole-5,6-diamine (PubChem CID 107490850) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 6-N-methyl-6-N-(2-methylsulfanylethyl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-methyl-6-N-(2-methylsulfanylethyl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107490850 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 6-N-methyl-6-N-(2-methylsulfanylethyl)-1H-indazole-5,6-diamine |
| SMILES | CSCCN(C)c1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C11H16N4S/c1-15(3-4-16-2)11-6-10-8(5-9(11)12)7-13-14-10/h5-7H,3-4,12H2,1-2H3,(H,13,14) |
| InChIKey | OAOBKZRDLKOJMD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|