C7H14N4O2 — CID 114988960
2-[(5-amino-1H-pyrazol-4-yl)-(2-hydroxyethyl)amino]ethanol (PubChem CID 114988960) has the molecular formula C7H14N4O2 and a molecular weight of 186.22 g/mol. Its IUPAC name is 2-[(5-amino-1H-pyrazol-4-yl)-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[(5-amino-1H-pyrazol-4-yl)-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 114988960 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 2-[(5-amino-1H-pyrazol-4-yl)-(2-hydroxyethyl)amino]ethanol |
| SMILES | Nc1[nH]ncc1N(CCO)CCO |
| InChI | InChI=1S/C7H14N4O2/c8-7-6(5-9-10-7)11(1-3-12)2-4-13/h5,12-13H,1-4H2,(H3,8,9,10) |
| InChIKey | VUXROVJXFAKTEI-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |