C9H11BrF2N2O — CID 107484125
2-[(3-bromo-4-pyridinyl)-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107484125) has the molecular formula C9H11BrF2N2O and a molecular weight of 281.10 g/mol. Its IUPAC name is 2-[(3-bromo-4-pyridinyl)-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[(3-bromo-4-pyridinyl)-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484125 |
| Molecular Formula | C9H11BrF2N2O |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-[(3-bromo-4-pyridinyl)-(2,2-difluoroethyl)amino]ethanol |
| SMILES | OCCN(CC(F)F)c1ccncc1Br |
| InChI | InChI=1S/C9H11BrF2N2O/c10-7-5-13-2-1-8(7)14(3-4-15)6-9(11)12/h1-2,5,9,15H,3-4,6H2 |
| InChIKey | DBOJZVJYEWMVNQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |