C9H10BrClF2N2 — CID 107490053
3-bromo-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-4-amine (PubChem CID 107490053) has the molecular formula C9H10BrClF2N2 and a molecular weight of 299.55 g/mol. Its IUPAC name is 3-bromo-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-4-amine.
| Compound Name | 3-bromo-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 107490053 |
| Molecular Formula | C9H10BrClF2N2 |
| Molecular Weight | 299.55 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 3-bromo-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-4-amine |
| SMILES | FC(F)CN(CCCl)c1ccncc1Br |
| InChI | InChI=1S/C9H10BrClF2N2/c10-7-5-14-3-1-8(7)15(4-2-11)6-9(12)13/h1,3,5,9H,2,4,6H2 |
| InChIKey | CEJLDQMNNBWJJV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|