C9H9Cl3F2N2 — CID 107489974
3,5-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-2-amine (PubChem CID 107489974) has the molecular formula C9H9Cl3F2N2 and a molecular weight of 289.54 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107489974 |
| Molecular Formula | C9H9Cl3F2N2 |
| Molecular Weight | 289.54 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 3,5-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyridin-2-amine |
| SMILES | FC(F)CN(CCCl)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3F2N2/c10-1-2-16(5-8(13)14)9-7(12)3-6(11)4-15-9/h3-4,8H,1-2,5H2 |
| InChIKey | VVJVCOCGGPPJKU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|