C11H16ClF2N3O — CID 107490116
3-[2-chloroethyl(2,2-difluoroethyl)amino]-1-propan-2-ylpyrazin-2-one (PubChem CID 107490116) has the molecular formula C11H16ClF2N3O and a molecular weight of 279.72 g/mol. Its IUPAC name is 3-[2-chloroethyl(2,2-difluoroethyl)amino]-1-propan-2-ylpyrazin-2-one.
| Compound Name | 3-[2-chloroethyl(2,2-difluoroethyl)amino]-1-propan-2-ylpyrazin-2-one |
|---|---|
| PubChem CID | 107490116 |
| Molecular Formula | C11H16ClF2N3O |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-[2-chloroethyl(2,2-difluoroethyl)amino]-1-propan-2-ylpyrazin-2-one |
| SMILES | CC(C)n1ccnc(N(CCCl)CC(F)F)c1=O |
| InChI | InChI=1S/C11H16ClF2N3O/c1-8(2)17-6-4-15-10(11(17)18)16(5-3-12)7-9(13)14/h4,6,8-9H,3,5,7H2,1-2H3 |
| InChIKey | FHIYWGGTUWMUNL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|