C8H10ClF2N3O — CID 107490132
3-[2-chloroethyl(2,2-difluoroethyl)amino]-1H-pyrazin-2-one (PubChem CID 107490132) has the molecular formula C8H10ClF2N3O and a molecular weight of 237.64 g/mol. Its IUPAC name is 3-[2-chloroethyl(2,2-difluoroethyl)amino]-1H-pyrazin-2-one.
| Compound Name | 3-[2-chloroethyl(2,2-difluoroethyl)amino]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 107490132 |
| Molecular Formula | C8H10ClF2N3O |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3-[2-chloroethyl(2,2-difluoroethyl)amino]-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1N(CCCl)CC(F)F |
| InChI | InChI=1S/C8H10ClF2N3O/c9-1-4-14(5-6(10)11)7-8(15)13-3-2-12-7/h2-3,6H,1,4-5H2,(H,13,15) |
| InChIKey | BJBDFBFZXJMVEU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|