C10H13ClF2N2 — CID 107489921
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine (PubChem CID 107489921) has the molecular formula C10H13ClF2N2 and a molecular weight of 234.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107489921 |
| Molecular Formula | C10H13ClF2N2 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N(CCCl)CC(F)F)c1 |
| InChI | InChI=1S/C10H13ClF2N2/c1-8-2-4-14-10(6-8)15(5-3-11)7-9(12)13/h2,4,6,9H,3,5,7H2,1H3 |
| InChIKey | MZEOQXKIIQQTMK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|