C10H12ClF2N5 — CID 107490073
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 107490073) has the molecular formula C10H12ClF2N5 and a molecular weight of 275.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 107490073 |
| Molecular Formula | C10H12ClF2N5 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(N(CCCl)CC(F)F)n2ncnc2n1 |
| InChI | InChI=1S/C10H12ClF2N5/c1-7-4-9(17(3-2-11)5-8(12)13)18-10(16-7)14-6-15-18/h4,6,8H,2-3,5H2,1H3 |
| InChIKey | PAWWQUMFNQVUAK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|