C11H15N5O — CID 115658382
2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-prop-2-enylamino]ethanol (PubChem CID 115658382) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-prop-2-enylamino]ethanol.
| Compound Name | 2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 115658382 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)c1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C11H15N5O/c1-3-4-15(5-6-17)10-7-9(2)14-11-12-8-13-16(10)11/h3,7-8,17H,1,4-6H2,2H3 |
| InChIKey | OOJHAIDSBDPTLS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|