C13H21N5O5 — CID 3512269
6-[methyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexane-1,2,3,4,5-pentol (PubChem CID 3512269) has the molecular formula C13H21N5O5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 6-[methyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[methyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 3512269 |
| Molecular Formula | C13H21N5O5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 6-[methyl-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexane-1,2,3,4,5-pentol |
| SMILES | Cc1cc(N(C)CC(O)C(O)C(O)C(O)CO)n2ncnc2n1 |
| InChI | InChI=1S/C13H21N5O5/c1-7-3-10(18-13(16-7)14-6-15-18)17(2)4-8(20)11(22)12(23)9(21)5-19/h3,6,8-9,11-12,19-23H,4-5H2,1-2H3 |
| InChIKey | KCMFHMJZADBZKN-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 147.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |