C7H9F2N3O — CID 114570348
3-[2,2-difluoroethyl(methyl)amino]-1H-pyrazin-2-one (PubChem CID 114570348) has the molecular formula C7H9F2N3O and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(methyl)amino]-1H-pyrazin-2-one.
| Compound Name | 3-[2,2-difluoroethyl(methyl)amino]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 114570348 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3-[2,2-difluoroethyl(methyl)amino]-1H-pyrazin-2-one |
| SMILES | CN(CC(F)F)c1ncc[nH]c1=O |
| InChI | InChI=1S/C7H9F2N3O/c1-12(4-5(8)9)6-7(13)11-3-2-10-6/h2-3,5H,4H2,1H3,(H,11,13) |
| InChIKey | QRBWQQHJGCGJRW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |