C11H17N5O2 — CID 114570905
3-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrazin-2-one (PubChem CID 114570905) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrazin-2-one.
| Compound Name | 3-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 114570905 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrazin-2-one |
| SMILES | CN(CC(=O)N1CCNCC1)c1ncc[nH]c1=O |
| InChI | InChI=1S/C11H17N5O2/c1-15(10-11(18)14-3-2-13-10)8-9(17)16-6-4-12-5-7-16/h2-3,12H,4-8H2,1H3,(H,14,18) |
| InChIKey | AKJRGHWIBAXMAE-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |