C12H19N5O3 — CID 136977630
5-methoxy-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrimidin-6-one (PubChem CID 136977630) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-methoxy-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136977630 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 5-methoxy-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]-1H-pyrimidin-6-one |
| SMILES | COc1c(N(C)CC(=O)N2CCNCC2)nc[nH]c1=O |
| InChI | InChI=1S/C12H19N5O3/c1-16(7-9(18)17-5-3-13-4-6-17)11-10(20-2)12(19)15-8-14-11/h8,13H,3-7H2,1-2H3,(H,14,15,19) |
| InChIKey | WNULIHWBVAXPNS-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |