C10H18N4O2 — CID 137008782
4-[3-aminobutyl(methyl)amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 137008782) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[3-aminobutyl(methyl)amino]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[3-aminobutyl(methyl)amino]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137008782 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4-[3-aminobutyl(methyl)amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(N(C)CCC(C)N)nc[nH]c1=O |
| InChI | InChI=1S/C10H18N4O2/c1-7(11)4-5-14(2)9-8(16-3)10(15)13-6-12-9/h6-7H,4-5,11H2,1-3H3,(H,12,13,15) |
| InChIKey | OKXIPTZFHWAVBL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |