C13H16N4O2 — CID 137009050
5-methoxy-4-[methyl(2-pyridin-2-ylethyl)amino]-1H-pyrimidin-6-one (PubChem CID 137009050) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-methoxy-4-[methyl(2-pyridin-2-ylethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-[methyl(2-pyridin-2-ylethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137009050 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-methoxy-4-[methyl(2-pyridin-2-ylethyl)amino]-1H-pyrimidin-6-one |
| SMILES | COc1c(N(C)CCc2ccccn2)nc[nH]c1=O |
| InChI | InChI=1S/C13H16N4O2/c1-17(8-6-10-5-3-4-7-14-10)12-11(19-2)13(18)16-9-15-12/h3-5,7,9H,6,8H2,1-2H3,(H,15,16,18) |
| InChIKey | IAHZGODQGCZMFQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |