C9H11ClF3N3O — CID 107490714
3-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1-methylpyrazin-2-one (PubChem CID 107490714) has the molecular formula C9H11ClF3N3O and a molecular weight of 269.65 g/mol. Its IUPAC name is 3-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1-methylpyrazin-2-one.
| Compound Name | 3-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 107490714 |
| Molecular Formula | C9H11ClF3N3O |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-[2-chloroethyl(2,2,2-trifluoroethyl)amino]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N(CCCl)CC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H11ClF3N3O/c1-15-5-3-14-7(8(15)17)16(4-2-10)6-9(11,12)13/h3,5H,2,4,6H2,1H3 |
| InChIKey | OFPCIUIHPJFCTE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|