C10H11BrClF3N2 — CID 107490631
5-bromo-N-(2-chloroethyl)-3-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 107490631) has the molecular formula C10H11BrClF3N2 and a molecular weight of 331.56 g/mol. Its IUPAC name is 5-bromo-N-(2-chloroethyl)-3-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(2-chloroethyl)-3-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107490631 |
| Molecular Formula | C10H11BrClF3N2 |
| Molecular Weight | 331.56 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5-bromo-N-(2-chloroethyl)-3-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C10H11BrClF3N2/c1-7-4-8(11)5-16-9(7)17(3-2-12)6-10(13,14)15/h4-5H,2-3,6H2,1H3 |
| InChIKey | QJOZRTMIXDPFBY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|