C11H17BrN2 — CID 115148475
5-bromo-N-tert-butyl-N,3-dimethylpyridin-2-amine (PubChem CID 115148475) has the molecular formula C11H17BrN2 and a molecular weight of 257.18 g/mol. Its IUPAC name is 5-bromo-N-tert-butyl-N,3-dimethylpyridin-2-amine.
| Compound Name | 5-bromo-N-tert-butyl-N,3-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 115148475 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-bromo-N-tert-butyl-N,3-dimethylpyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1N(C)C(C)(C)C |
| InChI | InChI=1S/C11H17BrN2/c1-8-6-9(12)7-13-10(8)14(5)11(2,3)4/h6-7H,1-5H3 |
| InChIKey | OQZGLGGLZBNKGB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |