C17H15BrN2 — CID 115148547
5-bromo-N,3-dimethyl-N-naphthalen-2-ylpyridin-2-amine (PubChem CID 115148547) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 5-bromo-N,3-dimethyl-N-naphthalen-2-ylpyridin-2-amine.
| Compound Name | 5-bromo-N,3-dimethyl-N-naphthalen-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 115148547 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-bromo-N,3-dimethyl-N-naphthalen-2-ylpyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1N(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H15BrN2/c1-12-9-15(18)11-19-17(12)20(2)16-8-7-13-5-3-4-6-14(13)10-16/h3-11H,1-2H3 |
| InChIKey | JVLBHNQMEWZFQX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |