C14H13BrN2O2 — CID 115148495
N-(1,3-benzodioxol-5-yl)-5-bromo-N,3-dimethylpyridin-2-amine (PubChem CID 115148495) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-bromo-N,3-dimethylpyridin-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-bromo-N,3-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 115148495 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-bromo-N,3-dimethylpyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1N(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13BrN2O2/c1-9-5-10(15)7-16-14(9)17(2)11-3-4-12-13(6-11)19-8-18-12/h3-7H,8H2,1-2H3 |
| InChIKey | IKVDINOBOOZGCE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |