C14H15N3O2 — CID 115147885
2-N-(1,3-benzodioxol-5-yl)-2-N,3-dimethylpyridine-2,5-diamine (PubChem CID 115147885) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-yl)-2-N,3-dimethylpyridine-2,5-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-yl)-2-N,3-dimethylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 115147885 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-yl)-2-N,3-dimethylpyridine-2,5-diamine |
| SMILES | Cc1cc(N)cnc1N(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H15N3O2/c1-9-5-10(15)7-16-14(9)17(2)11-3-4-12-13(6-11)19-8-18-12/h3-7H,8,15H2,1-2H3 |
| InChIKey | JFGSMUUZIVIKKH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |