C13H12ClF3N2 — CID 107490693
N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)isoquinolin-1-amine (PubChem CID 107490693) has the molecular formula C13H12ClF3N2 and a molecular weight of 288.70 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)isoquinolin-1-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 107490693 |
| Molecular Formula | C13H12ClF3N2 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)isoquinolin-1-amine |
| SMILES | FC(F)(F)CN(CCCl)c1nccc2ccccc12 |
| InChI | InChI=1S/C13H12ClF3N2/c14-6-8-19(9-13(15,16)17)12-11-4-2-1-3-10(11)5-7-18-12/h1-5,7H,6,8-9H2 |
| InChIKey | XNGQSUYXZMMJJO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|