C11H15BrCl2N2 — CID 107205213
N-(5-bromopentyl)-3,5-dichloro-N-methylpyridin-2-amine (PubChem CID 107205213) has the molecular formula C11H15BrCl2N2 and a molecular weight of 326.07 g/mol. Its IUPAC name is N-(5-bromopentyl)-3,5-dichloro-N-methylpyridin-2-amine.
| Compound Name | N-(5-bromopentyl)-3,5-dichloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107205213 |
| Molecular Formula | C11H15BrCl2N2 |
| Molecular Weight | 326.07 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | N-(5-bromopentyl)-3,5-dichloro-N-methylpyridin-2-amine |
| SMILES | CN(CCCCCBr)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15BrCl2N2/c1-16(6-4-2-3-5-12)11-10(14)7-9(13)8-15-11/h7-8H,2-6H2,1H3 |
| InChIKey | IDAOYPZAEGJFDK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|