C10H17ClN4 — CID 107207100
N'-(5-chloropyrimidin-4-yl)-N'-methylpentane-1,5-diamine (PubChem CID 107207100) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is N'-(5-chloropyrimidin-4-yl)-N'-methylpentane-1,5-diamine.
| Compound Name | N'-(5-chloropyrimidin-4-yl)-N'-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 107207100 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N'-(5-chloropyrimidin-4-yl)-N'-methylpentane-1,5-diamine |
| SMILES | CN(CCCCCN)c1ncncc1Cl |
| InChI | InChI=1S/C10H17ClN4/c1-15(6-4-2-3-5-12)10-9(11)7-13-8-14-10/h7-8H,2-6,12H2,1H3 |
| InChIKey | GGEVOXFNARDFIJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|