C9H15ClN4 — CID 105369023
N'-(5-chloropyrimidin-4-yl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 105369023) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is N'-(5-chloropyrimidin-4-yl)-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-(5-chloropyrimidin-4-yl)-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 105369023 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N'-(5-chloropyrimidin-4-yl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)c1ncncc1Cl |
| InChI | InChI=1S/C9H15ClN4/c1-11-4-3-5-14(2)9-8(10)6-12-7-13-9/h6-7,11H,3-5H2,1-2H3 |
| InChIKey | DKCBBBCTRCHWJW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|