C11H17N5 — CID 103468814
5-amino-6-[methyl-[3-(methylamino)propyl]amino]pyridine-3-carbonitrile (PubChem CID 103468814) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-amino-6-[methyl-[3-(methylamino)propyl]amino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-[methyl-[3-(methylamino)propyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103468814 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 5-amino-6-[methyl-[3-(methylamino)propyl]amino]pyridine-3-carbonitrile |
| SMILES | CNCCCN(C)c1ncc(C#N)cc1N |
| InChI | InChI=1S/C11H17N5/c1-14-4-3-5-16(2)11-10(13)6-9(7-12)8-15-11/h6,8,14H,3-5,13H2,1-2H3 |
| InChIKey | VORQKTCTGZJTQT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|