C11H19N3O — CID 66279324
2-N-(3-methoxypropyl)-2-N,5-dimethylpyridine-2,3-diamine (PubChem CID 66279324) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-N-(3-methoxypropyl)-2-N,5-dimethylpyridine-2,3-diamine.
| Compound Name | 2-N-(3-methoxypropyl)-2-N,5-dimethylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 66279324 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-N-(3-methoxypropyl)-2-N,5-dimethylpyridine-2,3-diamine |
| SMILES | COCCCN(C)c1ncc(C)cc1N |
| InChI | InChI=1S/C11H19N3O/c1-9-7-10(12)11(13-8-9)14(2)5-4-6-15-3/h7-8H,4-6,12H2,1-3H3 |
| InChIKey | TZJUXTRYSGPFIO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|