C11H16N4O — CID 103469180
5-amino-6-[3-hydroxybutyl(methyl)amino]pyridine-3-carbonitrile (PubChem CID 103469180) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 5-amino-6-[3-hydroxybutyl(methyl)amino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-[3-hydroxybutyl(methyl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103469180 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-amino-6-[3-hydroxybutyl(methyl)amino]pyridine-3-carbonitrile |
| SMILES | CC(O)CCN(C)c1ncc(C#N)cc1N |
| InChI | InChI=1S/C11H16N4O/c1-8(16)3-4-15(2)11-10(13)5-9(6-12)7-14-11/h5,7-8,16H,3-4,13H2,1-2H3 |
| InChIKey | CCWDDQNDEULVBU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |