About N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine
N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine (PubChem CID 112709407) has the molecular formula C7H13N5
and a molecular weight of 167.22 g/mol. Its IUPAC name is N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine.
Analyze N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine?
The IUPAC name of N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine (CID 112709407) is N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine.
What is the SMILES notation for N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine?
The canonical SMILES for N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine is CN(CCCN)c1cncnn1.
What is the InChIKey of N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine?
The InChIKey is JWQMFNKYGHPZCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5/c1-12(4-2-3-8)7-5-9-6-10-11-7/h5-6H,2-4,8H2,1H3.
What are the key properties of N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine?
N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine has a molecular weight of 167.22 g/mol, XLogP of -0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(1,2,4-triazin-6-yl)propane-1,3-diamine is sourced from PubChem (CID 112709407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).